74287-36-8 Usage
General Description
1-[2-[2-(4-chlorophenoxy)ethoxy]-2-(2,4-dichlorophenyl)vinyl]-1H-imidazolium nitrate is a complex chemical compound with a long name, but its structure indicates that it likely has biological activity. The compound contains an imidazolium ring, which is a common structural motif found in many biologically active compounds. The presence of the nitrate group indicates that it is a salt, and the presence of the chlorophenyl and chlorophenoxy groups suggests that it may have herbicidal or pesticidal properties. The compound's specific chemical structure would likely make it useful in various biochemical and pharmaceutical applications and may also indicate potential toxicological effects. Further research and testing would be needed to fully understand the properties and potential uses of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 74287-36-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,2,8 and 7 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 74287-36:
(7*7)+(6*4)+(5*2)+(4*8)+(3*7)+(2*3)+(1*6)=148
148 % 10 = 8
So 74287-36-8 is a valid CAS Registry Number.
InChI:InChI=1/C19H15Cl3N2O2.NO3/c20-14-1-4-16(5-2-14)25-9-10-26-19(12-24-8-7-23-13-24)17-6-3-15(21)11-18(17)22;2-1(3)4/h1-8,11-13H,9-10H2;/q;-1/p+1/b19-12+;