74367-31-0 Usage
Uses
Used in Pharmaceutical Industry:
Isobutyric acid 2-ethyl-3-hydroxyhexyl ester is used as an intermediate compound for the synthesis of pharmaceuticals, contributing to the development of new drugs and medications. Its role in the synthesis process is crucial for creating complex organic molecules that can be used in various therapeutic applications.
Used in Polymer Industry:
Isobutyric acid 2-ethyl-3-hydroxyhexyl ester is used as a building block in the production of polymers, which are large molecules composed of repeating structural units. Its incorporation into the polymer structure can influence the final properties of the material, such as its strength, flexibility, and durability.
Used in Fragrance Industry:
Isobutyric acid 2-ethyl-3-hydroxyhexyl ester is used as a fragrance ingredient due to its strong, fruity odors. It can be incorporated into perfumes, colognes, and other scented products to provide a unique and pleasant aroma.
Used in Flavor Industry:
Similar to its use in the fragrance industry, isobutyric acid 2-ethyl-3-hydroxyhexyl ester is also used as a flavoring agent in the food and beverage industry. Its fruity scent can be used to enhance the taste of various products, such as candies, beverages, and other food items.
Check Digit Verification of cas no
The CAS Registry Mumber 74367-31-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,3,6 and 7 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 74367-31:
(7*7)+(6*4)+(5*3)+(4*6)+(3*7)+(2*3)+(1*1)=140
140 % 10 = 0
So 74367-31-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H28O3/c1-4-5-6-7-8-9-10-13(15)14(16)17-11-12(2)3/h12-13,15H,4-11H2,1-3H3
