74407-70-8 Usage
Description
(R)-3-(benzoylthio)-2-methylpropionic acid is a unique organic compound belonging to the phenylthioacetic acid class. It features an alpha-methyl branched fatty acid structure with a phenylthio substituent at the third position and a benzoyl group at the first position. (R)-3-(benzoylthio)-2-methylpropionic acid is known for its distinctive structural attributes, which render it a valuable component in the development of innovative pharmaceuticals and therapeutic agents.
Uses
Used in Pharmaceutical Industry:
(R)-3-(benzoylthio)-2-methylpropionic acid serves as a crucial building block in the synthesis of a variety of drugs and active pharmaceutical ingredients. Its distinctive structural features contribute to the creation of new medications and therapeutic agents, enhancing the range of treatments available for various health conditions.
Used in Organic Synthesis:
(R)-3-(benzoylthio)-2-methylpropionic acid is utilized in organic synthesis due to its diverse reactivity and adaptability in chemical transformations. This makes it a valuable component in the development of new chemical compounds and materials.
Used in Chemical Research:
(R)-3-(benzoylthio)-2-methylpropionic acid's versatility in chemical reactions also makes it a valuable tool in chemical research, where it can be employed to explore novel reaction pathways and mechanisms, potentially leading to advancements in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 74407-70-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,4,0 and 7 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 74407-70:
(7*7)+(6*4)+(5*4)+(4*0)+(3*7)+(2*7)+(1*0)=128
128 % 10 = 8
So 74407-70-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H12O3S/c1-8(10(12)13)7-15-11(14)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,13)/t8-/m0/s1
