74417-12-2 Usage
Chemical structure
The compound has a triazine ring structure with chlorophenyl and phenylmethoxy substituents.
Classification
It is a heterocyclic compound.
Potential applications
The compound has potential applications in medicinal chemistry and pharmaceutical research.
Unique properties
The presence of the chlorophenyl and phenylmethoxy groups in the molecule gives it unique properties that could be useful for the development of new drugs and biologically active compounds.
Industrial applications
The compound may also have potential industrial applications in the synthesis of specialty chemicals and materials.
Further research needed
Additional research and testing are required to fully understand the potential uses and properties of 1,2,4-Triazine, 5-(3-chlorophenyl)-3-(phenylmethoxy)-.
Check Digit Verification of cas no
The CAS Registry Mumber 74417-12-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,4,1 and 7 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 74417-12:
(7*7)+(6*4)+(5*4)+(4*1)+(3*7)+(2*1)+(1*2)=122
122 % 10 = 2
So 74417-12-2 is a valid CAS Registry Number.
InChI:InChI=1/C16H12ClN3O/c17-14-8-4-7-13(9-14)15-10-18-20-16(19-15)21-11-12-5-2-1-3-6-12/h1-10H,11H2
