74578-10-2 Usage
General Description
"4-[(2,6-dichlorophenyl)(4-imino-3,5-dimethylcyclohexa-2,5-dien-1-ylidene)methyl]-2,6-xylidine phosphate (1:1)" is a complex chemical compound. It is composed of various components, including 2,6-dichlorophenyl, 4-imino-3,5-dimethylcyclohexa-2,5-dien-1-ylidene and 2,6-xylidine, combined under formulated conditions to create this compound. The compound is usually formed in a 1:1 ratio, suggesting the presence of equal amounts of each component in the compound mixture. The specific characteristics, purpose, and functionalities of this chemical largely depend on its structure, its chemical interaction with other substances, and the context in which it is used. The phosphate part indicates the relation of the compound with a phosphate group which often plays significant roles in biological systems. Note that safety measures should always be followed when handling chemicals, due to potential hazards and health risks associated with exposure.
Check Digit Verification of cas no
The CAS Registry Mumber 74578-10-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,5,7 and 8 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 74578-10:
(7*7)+(6*4)+(5*5)+(4*7)+(3*8)+(2*1)+(1*0)=152
152 % 10 = 2
So 74578-10-2 is a valid CAS Registry Number.
InChI:InChI=1/C23H22Cl2N2.H3O4P/c1-12-8-16(9-13(2)22(12)26)20(21-18(24)6-5-7-19(21)25)17-10-14(3)23(27)15(4)11-17;1-5(2,3)4/h5-11,26H,27H2,1-4H3;(H3,1,2,3,4)/b20-16-,26-22-;