745783-84-0 Usage
Uses
Used in Pharmaceutical Industry:
(R)-(-)-3-METHYL-2-BUTYL ISOCYANATE is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its reactivity allows for the formation of a wide range of drug molecules, contributing to the development of new medications and therapies.
Used in Pesticide Industry:
In the pesticide industry, (R)-(-)-3-METHYL-2-BUTYL ISOCYANATE serves as a crucial component in the production of certain pesticides. Its ability to form stable bonds with other molecules enables the creation of effective and long-lasting pest control agents.
Used in Polymer Industry:
(R)-(-)-3-METHYL-2-BUTYL ISOCYANATE is utilized as a monomer or a reactant in the polymer industry. Its reactivity plays a significant role in the synthesis of various types of polymers, which have a broad range of applications in different sectors, including automotive, construction, and electronics.
Check Digit Verification of cas no
The CAS Registry Mumber 745783-84-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,4,5,7,8 and 3 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 745783-84:
(8*7)+(7*4)+(6*5)+(5*7)+(4*8)+(3*3)+(2*8)+(1*4)=210
210 % 10 = 0
So 745783-84-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO/c1-5(2)6(3)7-4-8/h5-6H,1-3H3/t6-/m1/s1
