745784-01-4 Usage
General Description
(R)-(+)-1-(4-Bromophenyl)ethyl isothiocyanate is a chemical compound with the molecular formula C10H9BrNS. It is an isothiocyanate derivative, which is a class of compounds known for their diverse biological activities. This specific compound is commonly used in organic synthesis and as a reagent in chemical reactions due to its ability to bind with a variety of molecules. It has also been studied for its potential pharmacological properties, including its potential as an anticancer agent. Additionally, it has been investigated for its potential use in the development of new drugs and pharmaceuticals. Overall, (R)-(+)-1-(4-Bromophenyl)ethyl isothiocyanate is an important compound with a range of potential applications in chemistry and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 745784-01-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,4,5,7,8 and 4 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 745784-01:
(8*7)+(7*4)+(6*5)+(5*7)+(4*8)+(3*4)+(2*0)+(1*1)=194
194 % 10 = 4
So 745784-01-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H8BrNS/c1-7(11-6-12)8-2-4-9(10)5-3-8/h2-5,7H,1H3/t7-/m1/s1