745817-38-3 Usage
Uses
Used in Pharmaceutical Development:
3-(4-FLUOROBENZYL)-PIPERIDINE HCL is used as a chemical intermediate for the synthesis of various pharmacological agents. Its unique structure allows it to be a potential candidate in the creation of new drugs, particularly those targeting specific biological receptors or pathways.
Used in Scientific Research:
In the field of scientific research, 3-(4-FLUOROBENZYL)-PIPERIDINE HCL is used as a research tool to study the interactions of compounds with biological systems. Its presence in research settings aids in understanding the mechanisms of action and potential therapeutic applications of related chemical entities.
Used in Chemical Synthesis:
3-(4-FLUOROBENZYL)-PIPERIDINE HCL is used as a building block in the synthesis of more complex molecules. Its versatility in chemical reactions makes it a valuable component in the creation of a wide range of chemical products, from pharmaceuticals to specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 745817-38-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,4,5,8,1 and 7 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 745817-38:
(8*7)+(7*4)+(6*5)+(5*8)+(4*1)+(3*7)+(2*3)+(1*8)=193
193 % 10 = 3
So 745817-38-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H16FN.ClH/c13-12-5-3-10(4-6-12)8-11-2-1-7-14-9-11;/h3-6,11,14H,1-2,7-9H2;1H
