7464-71-3 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 9 carbon (C), 10 hydrogen (H), 4 nitrogen (N), and 2 oxygen (O) atoms.
Explanation
The compound belongs to the triazolopyrimidine family, which is a group of chemical compounds containing a fused triazole and pyrimidine ring system.
Explanation
Due to its unique chemical structure, the compound may exhibit various biological activities and pharmacological properties, making it a candidate for further research in the development of new drugs and therapies.
Explanation
The specific biological activities of this compound are not yet known and would require further studies to determine its potential effects on biological systems.
Explanation
The compound's pharmacological properties, such as its mechanism of action, target receptors, and potential therapeutic uses, are not yet known and would require further research to fully understand.
Explanation
The compound's structure is characterized by the fusion of a triazole and a pyrimidine ring, with additional functional groups (1-acetyl and 4,6-dimethyl) providing unique chemical and biological properties.
Explanation
To fully understand the potential uses and effects of this chemical compound, additional research and studies are required, including its synthesis, biological evaluation, and pharmacological characterization.
Chemical Family
Triazolopyrimidine
Substitution Pattern
1-acetyl-4,6-dimethyl
Potential Applications
Pharmaceutical research and drug development
Biological Activities
Unknown (requires further research)
Pharmacological Properties
Unknown (requires further research)
Structural Features
Fused triazole and pyrimidine rings, 1-acetyl and 4,6-dimethyl substitutions
Research Status
Further studies and research needed
Check Digit Verification of cas no
The CAS Registry Mumber 7464-71-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,6 and 4 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 7464-71:
(6*7)+(5*4)+(4*6)+(3*4)+(2*7)+(1*1)=113
113 % 10 = 3
So 7464-71-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N5O3/c1-4(14)13-5-6(9-10-13)11(2)8(16)12(3)7(5)15/h1-3H3