7466-13-9 Usage
Uses
Used in Pharmaceutical Industry:
5-Pyrimidinecarbonitrile, 2,4-diamino-6-methyl(8CI) is used as a chemical intermediate for the synthesis of various pharmaceutical drugs. Its unique structure allows it to be a key component in the development of new medications with potential therapeutic benefits.
Used in Agricultural Industry:
In the agricultural sector, 5-Pyrimidinecarbonitrile, 2,4-diamino-6-methyl(8CI) serves as a building block for the production of agrochemicals. Its properties make it suitable for the development of new pesticides, herbicides, and other agricultural chemicals that can improve crop yield and protect plants from pests and diseases.
Safety Precautions:
Due to its potential hazards, 5-Pyrimidinecarbonitrile, 2,4-diamino-6-methyl(8CI) should be handled and used with appropriate safety measures in place. This includes wearing protective equipment, working in well-ventilated areas, and following proper disposal procedures to minimize risks to human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 7466-13-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,6 and 6 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 7466-13:
(6*7)+(5*4)+(4*6)+(3*6)+(2*1)+(1*3)=109
109 % 10 = 9
So 7466-13-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N5/c1-3-4(2-7)5(8)11-6(9)10-3/h1H3,(H4,8,9,10,11)
