7467-92-7 Usage
Uses
Used in Organic Synthesis:
6-Quinoxalinol, 1,4-dioxide is utilized as a key intermediate in organic synthesis for the production of various complex organic molecules. Its unique structure allows it to serve as a building block for the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 6-Quinoxalinol, 1,4-dioxide is used as a starting material for the development of new drugs. Its biological activity as an antimicrobial and anticancer agent makes it a promising candidate for the treatment of various diseases and disorders.
Used in Antimicrobial Applications:
6-Quinoxalinol, 1,4-dioxide is employed as an antimicrobial agent, effective against a range of bacteria and other microorganisms. Its ability to disrupt microbial cell functions contributes to its potential use in the development of new antimicrobial drugs and treatments.
Used in Anticancer Applications:
6-Quinoxalinol, 1,4-dioxide is used as an anticancer agent, targeting and inhibiting the growth of cancer cells. Its potential to interfere with cancer cell metabolism and proliferation makes it a valuable compound in the search for new cancer therapies.
Used in Materials Science:
In the field of materials science, 6-Quinoxalinol, 1,4-dioxide has been studied for its potential applications in the development of organic semiconductors and optoelectronic devices. Its electronic properties and compatibility with other materials make it a candidate for use in the creation of advanced electronic and photonic devices.
Used in Optoelectronic Devices:
6-Quinoxalinol, 1,4-dioxide is utilized in the development of optoelectronic devices, such as solar cells, light-emitting diodes (LEDs), and photodetectors. Its ability to interact with light and its electronic properties contribute to the performance and efficiency of these devices.
Check Digit Verification of cas no
The CAS Registry Mumber 7467-92-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,6 and 7 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7467-92:
(6*7)+(5*4)+(4*6)+(3*7)+(2*9)+(1*2)=127
127 % 10 = 7
So 7467-92-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H5N2O3/c11-6-1-2-7-8(5-6)10(13)4-3-9(7)12/h1-5H/q+1/p+1