7471-06-9 Usage
Uses
Used in Pharmaceutical Industry:
1H-Benzimidazole,4-ethoxy-(9CI) is used as a pharmaceutical intermediate for the synthesis of various drugs and therapeutic agents. Its unique structure and properties may contribute to the development of new medications with specific therapeutic effects.
Used in Agricultural Industry:
1H-Benzimidazole,4-ethoxy-(9CI) is used as a chemical component in the formulation of agrochemicals, such as pesticides and herbicides. Its potential reactivity and interaction with other compounds may enhance the effectiveness of these products in controlling pests and weeds.
Used in Materials Science:
1H-Benzimidazole,4-ethoxy-(9CI) is used as a building block in the development of new materials with specific properties. Its chemical structure and reactivity may contribute to the creation of advanced materials for various applications, including electronics, coatings, and adhesives.
Note: The specific applications and reasons mentioned above are hypothetical and provided as examples based on the general properties of 1H-Benzimidazole,4-ethoxy-(9CI). Further research and development are necessary to validate these applications and explore additional uses in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 7471-06-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,7 and 1 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 7471-06:
(6*7)+(5*4)+(4*7)+(3*1)+(2*0)+(1*6)=99
99 % 10 = 9
So 7471-06-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O/c1-2-12-8-5-3-4-7-9(8)11-6-10-7/h3-6H,2H2,1H3,(H,10,11)
