7473-12-3 Usage
Uses
Used in Pharmaceutical Industry:
Isoquinoline, 8-nitro(7CI,8CI,9CI) is used as an intermediate in the synthesis of various pharmaceutical compounds for its unique chemical properties and reactivity. Its presence in the molecular structure can influence the pharmacological activity and therapeutic effects of the final drug products.
Used in Organic Synthesis:
Isoquinoline, 8-nitro(7CI,8CI,9CI) is utilized as a building block in the production of other organic compounds, contributing to the development of new chemical entities with potential applications in various fields, including materials science, agrochemicals, and specialty chemicals.
Used in Research and Development:
Isoquinoline, 8-nitro(7CI,8CI,9CI) is employed in research and development settings to explore its chemical properties, reactivity, and potential applications in the synthesis of novel compounds. Its unique structure allows researchers to investigate new reaction pathways and develop innovative synthetic methods.
Check Digit Verification of cas no
The CAS Registry Mumber 7473-12-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,7 and 3 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7473-12:
(6*7)+(5*4)+(4*7)+(3*3)+(2*1)+(1*2)=103
103 % 10 = 3
So 7473-12-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H6N2O2/c12-11(13)9-3-1-2-7-4-5-10-6-8(7)9/h1-6H
