747405-49-8 Usage
Uses
Used in Pharmaceutical Industry:
2,3,4,5-Tetrafluoro-D-Phenylalanine is used as a building block for the synthesis of fluorinated pharmaceuticals and biologically active molecules. The incorporation of fluorine atoms in 2,3,4,5-Tetrafluoro-D-Phenylalanine can improve the binding affinities and metabolic stability of drug candidates, leading to enhanced therapeutic effects and reduced side effects.
Used in Medicinal Chemistry Research:
2,3,4,5-Tetrafluoro-D-Phenylalanine is used as a research tool in medicinal chemistry for the development of novel drug candidates. Its unique structure and properties make it a promising compound for the design and synthesis of new pharmaceuticals with improved pharmacokinetic and pharmacodynamic profiles.
Used in Drug Development:
2,3,4,5-Tetrafluoro-D-Phenylalanine is used in drug development for the creation of innovative therapeutic agents. Its potential to enhance the binding affinities and metabolic stability of drug candidates makes it a valuable asset in the development of more effective and safer medications for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 747405-49-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,4,7,4,0 and 5 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 747405-49:
(8*7)+(7*4)+(6*7)+(5*4)+(4*0)+(3*5)+(2*4)+(1*9)=178
178 % 10 = 8
So 747405-49-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H7F4NO2/c10-4-1-3(2-5(14)9(15)16)6(11)8(13)7(4)12/h1,5H,2,14H2,(H,15,16)/t5-/m1/s1
