7477-12-5 Usage
Uses
Used in Pharmaceutical Industry:
Tetrazolo[1,5-a]pyridine-5-carboxylic acid serves as a key intermediate in the synthesis of various drug molecules, particularly those targeting neurological disorders. Its anticonvulsant and neuroprotective properties make it an ideal candidate for the development of medications aimed at treating conditions such as epilepsy and other seizure-related disorders.
Used in Medicinal Chemistry Research:
In the realm of medicinal chemistry, tetrazolo[1,5-a]pyridine-5-carboxylic acid is utilized as a building block for the design and synthesis of novel compounds with potential therapeutic applications. Its unique structure allows researchers to explore its interactions with biological targets and develop new drugs with improved efficacy and safety profiles.
Used in Drug Discovery Efforts:
Tetrazolo[1,5-a]pyridine-5-carboxylic acid plays a significant role in drug discovery efforts, where it is employed as a starting point for the development of new pharmaceutical agents. Its biological activities and chemical properties are harnessed to create innovative treatments for a range of neurological conditions, contributing to the advancement of medical science and patient care.
Check Digit Verification of cas no
The CAS Registry Mumber 7477-12-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,7 and 7 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7477-12:
(6*7)+(5*4)+(4*7)+(3*7)+(2*1)+(1*2)=115
115 % 10 = 5
So 7477-12-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H4N4O2/c11-6(12)4-2-1-3-5-7-8-9-10(4)5/h1-3H,(H,11,12)
