74800-54-7 Usage
Uses
Used in Organic Synthesis:
Trans-2-(4-Cyanophenyl)-5-N-butyl-1,3-dioxane is used as a building block in organic synthesis for the creation of various complex organic molecules. Its unique structure allows for the formation of new chemical entities with potential applications in different industries.
Used in Pharmaceutical Research:
In the pharmaceutical industry, trans-2-(4-Cyanophenyl)-5-N-butyl-1,3-dioxane is used as a research compound to explore its potential as a therapeutic agent. Its specific properties may contribute to the development of new drugs with novel mechanisms of action.
Used in Agrochemical Development:
Trans-2-(4-Cyanophenyl)-5-N-butyl-1,3-dioxane may also be utilized in the agrochemical sector for the development of new pesticides or herbicides. Its chemical structure could provide a basis for the design of more effective and environmentally friendly agrochemicals.
Used in Materials Science:
In the field of materials science, trans-2-(4-Cyanophenyl)-5-N-butyl-1,3-dioxane could be employed in the development of new materials with unique properties. Its incorporation into polymers or other materials may lead to advancements in areas such as electronics, coatings, or adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 74800-54-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,8,0 and 0 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 74800-54:
(7*7)+(6*4)+(5*8)+(4*0)+(3*0)+(2*5)+(1*4)=127
127 % 10 = 7
So 74800-54-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H19NO2/c1-2-3-4-13-10-17-15(18-11-13)14-7-5-12(9-16)6-8-14/h5-8,13,15H,2-4,10-11H2,1H3
