74885-64-6 Usage
Description
3-(2-AMINO-ETHYL)-2-METHYL-1H-INDOLE-5-CARBONITRILE is a chemical compound characterized by an indole ring structure, which is further functionalized with an ethylamine and a methyl group. It is a carbonitrile, meaning it contains a cyano group (-CN), and is recognized for its potential in medicinal and pharmaceutical research due to its unique structural features and functional groups. 3-(2-AMINO-ETHYL)-2-METHYL-1H-INDOLE-5-CARBONITRILE could serve as a valuable building block or intermediate in the synthesis of various drug compounds, making it an intriguing subject for exploration in the realms of organic and medicinal chemistry.
Uses
Used in Medicinal Chemistry Research:
3-(2-AMINO-ETHYL)-2-METHYL-1H-INDOLE-5-CARBONITRILE is used as a building block for the synthesis of new drug compounds, leveraging its unique indole ring structure and functional groups to create novel therapeutic agents.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-(2-AMINO-ETHYL)-2-METHYL-1H-INDOLE-5-CARBONITRILE is utilized as an intermediate in the development of pharmaceuticals, potentially contributing to the creation of innovative medications with improved efficacy and selectivity.
Used in Organic Chemistry:
3-(2-AMINO-ETHYL)-2-METHYL-1H-INDOLE-5-CARBONITRILE is employed as a reagent or substrate in various organic synthesis processes, taking advantage of its chemical properties to facilitate the formation of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 74885-64-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,8,8 and 5 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 74885-64:
(7*7)+(6*4)+(5*8)+(4*8)+(3*5)+(2*6)+(1*4)=176
176 % 10 = 6
So 74885-64-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N3/c1-8-10(4-5-13)11-6-9(7-14)2-3-12(11)15-8/h2-3,6,15H,4-5,13H2,1H3