74899-63-1 Usage
General Description
The chemical compound "(+)-L-Arg-[(4S)-4-Hydroxy-L-Arg-]-D-Orn-L-Thr-D-Orn-[(4S)-4-hydroxy-L-Arg-]-D-Tyr-OH" is a complex peptide composed of several amino acids. It contains L-arginine, D-ornithine, L-threonine, D-tyrosine, and 4-hydroxy-L-arginine. These amino acids are essential for protein synthesis and play key roles in various biological processes in the body. The presence of hydroxy-L-arginine indicates that this compound may have specific functions related to nitric oxide metabolism or signaling pathways. The combination of these amino acids in this specific sequence likely contributes to the compound's unique properties and potential biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 74899-63-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,8,9 and 9 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 74899-63:
(7*7)+(6*4)+(5*8)+(4*9)+(3*9)+(2*6)+(1*3)=191
191 % 10 = 1
So 74899-63-1 is a valid CAS Registry Number.
InChI:InChI=1/C41H74N18O12/c1-20(60)31(59-34(66)27(7-3-13-43)54-35(67)28(16-23(62)18-52-40(47)48)56-32(64)25(44)5-4-14-51-39(45)46)37(69)55-26(6-2-12-42)33(65)57-29(17-24(63)19-53-41(49)50)36(68)58-30(38(70)71)15-21-8-10-22(61)11-9-21/h8-11,20,23-31,60-63H,2-7,12-19,42-44H2,1H3,(H,54,67)(H,55,69)(H,56,64)(H,57,65)(H,58,68)(H,59,66)(H,70,71)(H4,45,46,51)(H4,47,48,52)(H4,49,50,53)/t20-,23+,24?,25+,26-,27-,28+,29+,30-,31+/m1/s1