74916-44-2 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 7 carbon (C) atoms, 6 hydrogen (H) atoms, 4 nitrogen (N) atoms, and 1 fluorine (F) atom.
Explanation
The compound belongs to the benzotriazine family, which is a group of chemical compounds containing a benzene ring fused to a triazine ring.
Explanation
The presence of a fluorine atom in the compound makes it a valuable tool in medicinal chemistry for the development of fluorinated pharmaceuticals.
Explanation
The compound is used as a building block in the synthesis of more complex organic molecules and is also utilized in pharmaceutical research for the development of new drugs and agrochemicals.
Explanation
The compound's unique chemical structure, which includes a benzene ring fused to a triazine ring, contributes to its reactivity and potential applications in the development of new drugs and agrochemicals.
Explanation
The compound's reactivity, due to its unique chemical structure and the presence of a fluorine atom, makes it a promising candidate for the development of new drugs and agrochemicals.
Explanation
The presence of a fluorine atom in the compound makes it a valuable tool in medicinal chemistry for the development of fluorinated pharmaceuticals, which often exhibit improved pharmacokinetic and pharmacodynamic properties compared to their non-fluorinated counterparts.
Chemical Family
Benzotriazine
Fluorine Atom
Contains a fluorine atom
Application
Building block in organic synthesis and pharmaceutical research
Unique Chemical Structure
Contains a benzene ring fused to a triazine ring
Reactivity
Potential applications in the development of new drugs and agrochemicals
Fluorinated Pharmaceuticals
Valuable tool in medicinal chemistry
Check Digit Verification of cas no
The CAS Registry Mumber 74916-44-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,9,1 and 6 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 74916-44:
(7*7)+(6*4)+(5*9)+(4*1)+(3*6)+(2*4)+(1*4)=152
152 % 10 = 2
So 74916-44-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H5FN4/c8-4-1-2-5-6(3-4)11-12-7(9)10-5/h1-3H,(H2,9,10,12)
