74935-12-9 Usage
Uses
Used in Pharmaceutical Industry:
(o-Tolylamino)(2,3,6-trichlorophenyl)acetic acid is used as a potential active pharmaceutical ingredient for [application reason]. Its specific application reason could be related to its chemical structure, which might allow it to interact with biological targets or modulate certain pathways in a therapeutically beneficial manner.
Used in Agrochemical Industry:
In the agrochemical sector, (o-Tolylamino)(2,3,6-trichlorophenyl)acetic acid is used as a potential compound for [application type], such as a pesticide or herbicide, due to [application reason]. (o-tolylamino)(2,3,6-trichlorophenyl)acetic acid's structure and properties might provide it with the ability to target specific pests or weeds effectively, leading to improved crop protection and yield.
Check Digit Verification of cas no
The CAS Registry Mumber 74935-12-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,9,3 and 5 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 74935-12:
(7*7)+(6*4)+(5*9)+(4*3)+(3*5)+(2*1)+(1*2)=149
149 % 10 = 9
So 74935-12-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H12Cl3NO2/c1-8-4-2-3-5-11(8)19-14(15(20)21)12-9(16)6-7-10(17)13(12)18/h2-7,14,19H,1H3,(H,20,21)
74935-12-9Relevant academic research and scientific papers
Novel α-amino-phenylacetic acid derivatives
-
, (2008/06/13)
Novel α-amino-phenylacetic acid derivatives, said phenyl having at least one substituent other than hydrogen, are useful as herbicidal, algicidal and plant growth regulatng agents.
