7494-56-6 Usage
General Description
The chemical compound "(E)-2-(dibutylamino)-1,4-bis(4-methylphenyl)but-2-ene-1,4-dione" is a complex organic compound with a long molecular structure. It contains a combination of butyl, amino, and methylphenyl groups. Its molecular formula indicates the presence of a conjugated system of double bonds, which gives it potential for electronic and optical applications. The compound's structure suggests that it may have potential uses in fields such as organic electronics, photovoltaics, and material science due to its unique electronic and optical properties. Additionally, the chemical's structure and functional groups may make it suitable for use in pharmaceuticals and drug development. However, further research and analysis are necessary to fully understand and harness the potential uses and applications of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 7494-56-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,9 and 4 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 7494-56:
(6*7)+(5*4)+(4*9)+(3*4)+(2*5)+(1*6)=126
126 % 10 = 6
So 7494-56-6 is a valid CAS Registry Number.
InChI:InChI=1/C26H33NO2/c1-5-7-17-27(18-8-6-2)24(26(29)23-15-11-21(4)12-16-23)19-25(28)22-13-9-20(3)10-14-22/h9-16,19H,5-8,17-18H2,1-4H3/b24-19-