74956-94-8 Usage
Uses
Used in Pharmaceutical Production:
Lithium difluoroacetate is used as a catalyst and reagent in the synthesis of various pharmaceutical compounds, contributing to the development of new drugs and improving the efficiency of existing manufacturing processes.
Used in Agrochemical Production:
In the agrochemical industry, lithium difluoroacetate is employed as a catalyst and reagent for the synthesis of agrochemicals, aiding in the production of pesticides, herbicides, and other agricultural chemicals to enhance crop protection and yield.
Used in Materials Science:
Lithium difluoroacetate is utilized in materials science for the synthesis of new materials with specific properties, such as high-performance polymers, advanced ceramics, and other materials with unique characteristics for various applications.
Used as a Catalyst in Organic Synthesis:
Lithium difluoroacetate is used as a catalyst in organic synthesis to facilitate specific chemical reactions, improving reaction rates and selectivity, and enabling the production of desired compounds with greater efficiency and purity.
Check Digit Verification of cas no
The CAS Registry Mumber 74956-94-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,4,9,5 and 6 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 74956-94:
(7*7)+(6*4)+(5*9)+(4*5)+(3*6)+(2*9)+(1*4)=178
178 % 10 = 8
So 74956-94-8 is a valid CAS Registry Number.
InChI:InChI=1/C2H2F2O2.Li/c3-1(4)2(5)6;/h1H,(H,5,6);/q;+1/p-1
