7496-55-1 Usage
Uses
Used in Pharmaceutical Industry:
4-CYCLOHEXYL-1,3-THIAZOL-2-AMINE is used as a key intermediate in the synthesis of pharmaceuticals for its potential biological activity. 4-CYCLOHEXYL-1,3-THIAZOL-2-AMINE contributes to the development of new therapeutic agents due to its pharmacological properties, including antimicrobial, antifungal, and anticancer actions.
Used in Agrochemical Industry:
In the agrochemical sector, 4-CYCLOHEXYL-1,3-THIAZOL-2-AMINE is utilized as a component in the synthesis of agrochemicals, leveraging its biological activity to create effective products for agricultural applications.
Used in Organic Chemistry Research:
4-CYCLOHEXYL-1,3-THIAZOL-2-AMINE serves as a valuable compound in organic chemistry research, where it is explored for its potential to form new chemical entities and understand its reactivity and interactions within various chemical systems.
Used as a Reagent in Chemical Reactions:
4-CYCLOHEXYL-1,3-THIAZOL-2-AMINE is also used as a reagent in various chemical reactions, facilitating specific transformations and syntheses that are essential in the preparation of complex organic molecules and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 7496-55-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,9 and 6 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 7496-55:
(6*7)+(5*4)+(4*9)+(3*6)+(2*5)+(1*5)=131
131 % 10 = 1
So 7496-55-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H14N2S/c10-9-11-8(6-12-9)7-4-2-1-3-5-7/h6-7H,1-5H2,(H2,10,11)
