75007-80-6 Usage
Heterocyclic organic compound
contains both an imidazole and a pyridine ring
Nitrophenyl group
potential biological activities, including antimicrobial and anticancer properties
Building block
used in the synthesis of various pharmaceutical compounds
Unique structure
significant interest in medicinal chemistry and drug discovery
Check Digit Verification of cas no
The CAS Registry Mumber 75007-80-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,0,0 and 7 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 75007-80:
(7*7)+(6*5)+(5*0)+(4*0)+(3*7)+(2*8)+(1*0)=116
116 % 10 = 6
So 75007-80-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H8N4O2/c17-16(18)11-4-2-1-3-8(11)12-14-9-5-6-13-7-10(9)15-12/h1-7H,(H,14,15)
