7501-09-9 Usage
Uses
Used in Pharmaceutical Research and Development:
CHEMBRDG-BB 7022461 is used as a research compound for its potential pharmaceutical applications, primarily due to its antimicrobial and antifungal activities. Its unique structure and properties make it a valuable asset in the search for new therapeutic agents.
Used in Antimicrobial Applications:
In the field of microbiology, CHEMBRDG-BB 7022461 is used as an antimicrobial agent to combat various types of bacteria. Its effectiveness in this area is attributed to its ability to disrupt bacterial cell functions, thereby inhibiting their growth and proliferation.
Used in Antifungal Applications:
Similarly, CHEMBRDG-BB 7022461 is utilized as an antifungal agent, targeting fungal infections by interfering with essential fungal processes. This application is crucial in treating a range of fungal diseases and controlling the spread of fungal pathogens.
Used in Anticancer Research:
Although still in the exploratory phase, CHEMBRDG-BB 7022461 is being investigated for its potential as an anticancer agent. Its possible role in this field is based on the compound's ability to interact with cellular mechanisms that may be implicated in the development and progression of cancer.
Used in Drug Development:
In the pharmaceutical industry, CHEMBRDG-BB 7022461 serves as a lead compound in drug development. Its unique chemical properties and biological activities are being studied to design and develop new drugs that can effectively treat various diseases, including infectious diseases and cancer.
Overall, CHEMBRDG-BB 7022461 is a versatile chemical compound with a broad spectrum of potential applications in the medical and pharmaceutical sectors. Its ongoing research and development efforts hold promise for future therapeutic advancements.
Check Digit Verification of cas no
The CAS Registry Mumber 7501-09-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,0 and 1 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 7501-09:
(6*7)+(5*5)+(4*0)+(3*1)+(2*0)+(1*9)=79
79 % 10 = 9
So 7501-09-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H12O3/c1-3-4-8-7-9(11(12)13)5-6-10(8)14-2/h3,5-7H,1,4H2,2H3,(H,12,13)
7501-09-9Relevant academic research and scientific papers
1-(PIPERIDIN-4-YL)-1H-INDOLE DERIVATIVE
-
Page/Page column 53, (2010/11/28)
The present invention provides a compound represented by the formula (1) or a pharmacologically acceptable salt thereof, or a hydrate thereof (provided that a compound in which all of R4a, R4b, and R4c are hydrogen atoms is excluded.): [wherein R1 represents a hydrogen atom, R2 represents a hydrogen atom, R3 represents the formula: wherein R4a, R4b, and R4c are the same as or different from each other and each represents a hydrogen atom, a C1-6 alkyl group or a C1-6 alkoxy group, etc.]