7505-99-9 Usage
Uses
Used in Pharmaceutical Industry:
1-(1,2,3,4,4a,4b,5,6,7,8,8a,10a-dodecahydrophenanthren-9-yl)ethanone is used as an intermediate in the production of various pharmaceuticals and synthetic compounds. Its role in this industry is crucial for the synthesis of a wide range of medications, contributing to the development of new therapeutic options.
Used in Perfumery and Fragrance Industry:
In the perfumery and fragrance industry, 1-(1,2,3,4,4a,4b,5,6,7,8,8a,10a-dodecahydrophenanthren-9-yl)ethanone is utilized in the synthesis of perfumes and fragrances. Its unique chemical properties allow it to contribute to the creation of distinct and complex scents, enhancing the variety of fragrances available in the market.
Used in Medicinal Chemistry Research:
1-(1,2,3,4,4a,4b,5,6,7,8,8a,10a-dodecahydrophenanthren-9-yl)ethanone is also considered to have potential pharmacological and biological activities. As a result, it is an important compound in the field of medicinal chemistry, where it is used in research and academic settings to explore its properties and possible applications in drug discovery and development.
Overall, 1-(1,2,3,4,4a,4b,5,6,7,8,8a,10a-dodecahydrophenanthren-9-yl)ethanone is a versatile compound with applications in the pharmaceutical, perfumery, and medicinal chemistry industries. Its unique properties and potential make it a valuable asset for the development of new products and the advancement of scientific knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 7505-99-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,0 and 5 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 7505-99:
(6*7)+(5*5)+(4*0)+(3*5)+(2*9)+(1*9)=109
109 % 10 = 9
So 7505-99-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H24O/c1-11(17)16-10-12-6-2-3-7-13(12)14-8-4-5-9-15(14)16/h10,12-15H,2-9H2,1H3