75080-11-4 Usage
Description
2-(Butylthio)-1H-benzo[d]imidazole, with the chemical formula C11H14N2S, is a heterocyclic compound belonging to the benzo[d]imidazole class. It features a benzene ring fused to an imidazole ring, which endows it with unique chemical properties and potential applications in various fields. As a potential enzyme inhibitor, it has garnered attention for its possible role in treating neurodegenerative diseases and holds promise for pharmaceutical development.
Uses
Used in Pharmaceutical Industry:
2-(Butylthio)-1H-benzo[d]imidazole is used as a potential enzyme inhibitor for its potential therapeutic effects in treating neurodegenerative diseases. Its ability to modulate enzyme activity makes it a candidate for further research and development in the context of disease management and treatment.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 2-(Butylthio)-1H-benzo[d]imidazole is utilized as a subject of interest for its potential pharmaceutical applications. Its unique chemical structure and properties are being explored for the development of new drugs and therapeutic agents, particularly for conditions that may benefit from enzyme inhibition.
Used in Scientific Research:
2-(Butylthio)-1H-benzo[d]imidazole is also used in scientific research to further understand its chemical behavior, interactions with biological systems, and potential applications in various industries. This research aids in uncovering new uses and optimizing its properties for specific applications, such as in drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 75080-11-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,0,8 and 0 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 75080-11:
(7*7)+(6*5)+(5*0)+(4*8)+(3*0)+(2*1)+(1*1)=114
114 % 10 = 4
So 75080-11-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2S/c1-2-3-8-14-11-12-9-6-4-5-7-10(9)13-11/h4-7H,2-3,8H2,1H3,(H,12,13)
