75202-24-3 Usage
Properties
+ Disinfectant and antiseptic agent
+ Broad-spectrum antimicrobial properties (effective against bacteria, viruses, and fungi)
+ Commonly used in healthcare settings
+ Found in mouthwashes, skin cleansers, and wound care products
+ Mechanism of action involves disrupting the cell membranes of microorganisms, leading to their destruction
+ Considered safe for topical use
Specific Content
+ Chlorhexidine is an effective disinfectant and antiseptic agent with a broad-spectrum of antimicrobial properties.
+ It is commonly used in healthcare settings to prevent and control infections.
+ Chlorhexidine is effective against a wide range of microorganisms, including bacteria, viruses, and fungi.
+ It is often found in personal care products such as mouthwashes, skin cleansers, and wound care products.
+ The mechanism of action of chlorhexidine involves disrupting the cell membranes of microorganisms, leading to their destruction.
+ Chlorhexidine is considered safe for topical use, but can cause irritation or allergic reactions in some individuals.
Check Digit Verification of cas no
The CAS Registry Mumber 75202-24-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,2,0 and 2 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 75202-24:
(7*7)+(6*5)+(5*2)+(4*0)+(3*2)+(2*2)+(1*4)=103
103 % 10 = 3
So 75202-24-3 is a valid CAS Registry Number.
InChI:InChI=1/C29H40Cl3NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-22-18-23(30)16-17-26(22)36-20-27(34)33-25-19-24(31)21(2)28(32)29(25)35/h16-19,35H,3-15,20H2,1-2H3,(H,33,34)