75214-12-9 Usage
Uses
Used in Pharmaceutical Industry:
METHYL 3-AMINO-4-[(1-BENZYL-2-METHOXY-2-OXOETHYL)AMINO]-4-OXOBUTANOATE HYDROCHLORIDE is used as a building block for synthesizing other compounds, contributing to the development of new pharmaceuticals. Its unique structure, including the amino, carboxylic acid ester, benzyl, methoxy, and ketone groups, allows for versatile chemical reactions and the creation of diverse molecules with potential therapeutic properties.
Used in Research Applications:
In the research field, METHYL 3-AMINO-4-[(1-BENZYL-2-METHOXY-2-OXOETHYL)AMINO]-4-OXOBUTANOATE HYDROCHLORIDE is used as a potential drug candidate. Its specific properties and potential uses are being explored through further studies and applications, with the aim of identifying its therapeutic potential and possible applications in treating various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 75214-12-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,2,1 and 4 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 75214-12:
(7*7)+(6*5)+(5*2)+(4*1)+(3*4)+(2*1)+(1*2)=109
109 % 10 = 9
So 75214-12-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H20N2O5.ClH/c1-21-13(18)9-11(16)14(19)17-12(15(20)22-2)8-10-6-4-3-5-7-10;/h3-7,11-12H,8-9,16H2,1-2H3,(H,17,19);1H/t11-,12+;/m0./s1
