752183-00-9 Usage
General Description
Isoquinoline, 6-(bromomethyl)- (9CI) is a chemical compound that belongs to the class of isoquinolines, which are organic compounds containing a benzene ring fused to a pyridine ring. This specific isoquinoline derivative contains a bromomethyl group attached to the sixth carbon atom of the ring. It is commonly used in the synthesis of various pharmaceuticals and organic compounds due to its versatile reactivity and functional groups. The bromomethyl substituent on the isoquinoline ring makes it useful in organic synthesis as a reactive intermediate for the introduction of other functional groups. Overall, Isoquinoline, 6-(bromomethyl)- (9CI) plays a crucial role in the production of diverse chemical compounds and has applications in the pharmaceutical and chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 752183-00-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,5,2,1,8 and 3 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 752183-00:
(8*7)+(7*5)+(6*2)+(5*1)+(4*8)+(3*3)+(2*0)+(1*0)=149
149 % 10 = 9
So 752183-00-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H8BrN/c11-6-8-1-2-10-7-12-4-3-9(10)5-8/h1-5,7H,6H2
