75219-61-3 Usage
General Description
[(8S,9S,13S,14S,17S)-17-(2-hydroxyacetyl)oxy-13-methyl-6,7,8,9,11,12,1 4,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate is a complex chemical compound with a molecular formula of C34H40O5. [(8S,9S,13S,14S,17S)-17-(2-hydroxyacetyl)oxy-13-methyl-6,7,8,9,11,12,1 4,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate is a steroid derivative with a benzoate group attached to the cyclopenta[a]phenanthrene structure. It is commonly used in the pharmaceutical industry as a synthetic intermediate in the production of various steroid medications. Additionally, this compound may have potential applications in research and development of new pharmaceutical products. Due to its complex structure and potential medicinal uses, [(8S,9S,13S,14S,17S)-17-(2-hydroxyacetyl)oxy-13-methyl-6,7,8,9,11,12,1 4,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate is a compound of interest for study and exploration in the field of organic chemistry and pharmaceutical science.
Check Digit Verification of cas no
The CAS Registry Mumber 75219-61-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,2,1 and 9 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 75219-61:
(7*7)+(6*5)+(5*2)+(4*1)+(3*9)+(2*6)+(1*1)=133
133 % 10 = 3
So 75219-61-3 is a valid CAS Registry Number.
InChI:InChI=1/C27H30O5/c1-27-14-13-21-20-10-8-19(31-26(30)17-5-3-2-4-6-17)15-18(20)7-9-22(21)23(27)11-12-24(27)32-25(29)16-28/h2-6,8,10,15,21-24,28H,7,9,11-14,16H2,1H3/t21-,22-,23+,24+,27+/m1/s1