7538-42-3 Usage
Uses
Used in Chemical Synthesis:
2-Buten-1-ylsuccinic anhydride is used as a reactive intermediate for the synthesis of a wide range of specialty chemicals and materials. Its ability to participate in various chemical reactions, such as esterification, amidation, and polymerization, makes it a key component in the development of new compounds and materials with specific properties.
Used in Adhesives Production:
In the adhesives industry, 2-Buten-1-ylsuccinic anhydride is used as a key component in the formulation of adhesives. Its reactivity and ability to form strong bonds with other materials contribute to the development of adhesives with enhanced performance characteristics, such as improved adhesion strength and durability.
Used in Coatings Industry:
2-Buten-1-ylsuccinic anhydride is utilized in the coatings industry as a component in the production of various types of coatings. Its reactivity allows for the creation of coatings with specific properties, such as increased resistance to wear, corrosion, and environmental factors, as well as improved aesthetic qualities.
Used in Plastics Manufacturing:
In the plastics manufacturing sector, 2-Buten-1-ylsuccinic anhydride is employed in the synthesis of different types of plastics. Its versatility in chemical reactions enables the production of plastics with tailored properties, such as enhanced strength, flexibility, and resistance to various environmental conditions.
Safety Precautions:
It is crucial to handle 2-buten-1-ylsuccinic anhydride with care, employing proper safety measures due to its potential irritant and corrosive properties. This ensures the protection of both the environment and the individuals involved in its production, handling, and application processes.
Check Digit Verification of cas no
The CAS Registry Mumber 7538-42-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,3 and 8 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7538-42:
(6*7)+(5*5)+(4*3)+(3*8)+(2*4)+(1*2)=113
113 % 10 = 3
So 7538-42-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H10O3/c1-2-3-4-6-5-7(9)11-8(6)10/h2-3,6H,4-5H2,1H3/b3-2+
