75380-54-0 Usage
Uses
Used in Pharmaceutical Industry:
1-(2,4-DIMETHYL-4H-PYRAZOLO[1,5-A]BENZIMIDAZOL-3-YL)ETHANONE is used as a potential pharmaceutical candidate for various applications due to its unique structural features. Its benzimidazole and pyrazole moieties, along with the ketone functional group, may contribute to its potential use in drug development and medicinal chemistry research.
Used in Medicinal Chemistry Research:
1-(2,4-DIMETHYL-4H-PYRAZOLO[1,5-A]BENZIMIDAZOL-3-YL)ETHANONE is used as a compound of interest in medicinal chemistry research. Its structural features may allow for the development of new drugs or the modification of existing ones, potentially leading to improved therapeutic options for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 75380-54-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,3,8 and 0 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 75380-54:
(7*7)+(6*5)+(5*3)+(4*8)+(3*0)+(2*5)+(1*4)=140
140 % 10 = 0
So 75380-54-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H13N3O/c1-8-12(9(2)17)13-15(3)10-6-4-5-7-11(10)16(13)14-8/h4-7H,1-3H3
75380-54-0Relevant academic research and scientific papers
SYNTHESIS OF 4-ALKYLPYRAZOLOBENZIMIDAZOLES
Kuz'menko, V. V.,Komissarov, V. N.,Simonov, A. M.
, p. 634 - 637 (2007/10/02)
2,4-Disubstituted pyrazolobenzimidazoles were obtained by the action of carboxylic acid anhydrides on 1-amino-2-methyl-3-alkylbenzimidazolium salts in the presence of potassium carbonate.
