754153-28-1 Usage
Uses
Used in Medicinal Chemistry and Pharmaceuticals:
5-Amino-2,3-dihydro-1H-indene-1-carboxylic acid methyl ester is utilized as a pharmaceutical intermediate for its biological activities, which can be harnessed in the development of new drugs. Its unique structure allows it to interact with biological targets, potentially leading to the creation of novel therapeutic agents.
Used in Organic Synthesis:
As a building block in organic synthesis, 5-Amino-2,3-dihydro-1H-indene-1-carboxylic acid methyl ester is employed for the synthesis of more complex organic molecules. Its reactivity and structural features make it a versatile component in the creation of a wide range of chemical compounds, including those with potential applications in various industries.
Used in Drug Discovery:
5-Amino-2,3-dihydro-1H-indene-1-carboxylic acid methyl ester is used as a key component in drug discovery processes. Its properties and reactivity contribute to the design and synthesis of new pharmaceutical compounds, aiding researchers in their quest to find innovative treatments for various diseases and conditions.
Used in Fine Chemical Synthesis:
In the field of fine chemical synthesis, 5-Amino-2,3-dihydro-1H-indene-1-carboxylic acid methyl ester is applied as a crucial intermediate. Its role in the synthesis of high-value specialty chemicals underscores its importance in creating products with specific applications in industries such as fragrances, dyes, and agrochemicals.
Used in Research and Development:
5-Amino-2,3-dihydro-1H-indene-1-carboxylic acid methyl ester is integral to research and development efforts in the chemical and pharmaceutical sectors. Its unique attributes and potential applications make it a subject of interest for scientists seeking to explore new avenues in chemical synthesis and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 754153-28-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,5,4,1,5 and 3 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 754153-28:
(8*7)+(7*5)+(6*4)+(5*1)+(4*5)+(3*3)+(2*2)+(1*8)=161
161 % 10 = 1
So 754153-28-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO2/c1-14-11(13)10-4-2-7-6-8(12)3-5-9(7)10/h3,5-6,10H,2,4,12H2,1H3
