75423-15-3 Usage
Uses
Used in Pharmaceutical Industry:
4-METHYL-1,2,3-THIADIAZOLE-5-CARBOXYLIC ACID is used as an active pharmaceutical ingredient for its antifungal activity. The thiadiazole moiety in the compound contributes to its effectiveness against various fungal infections, making it a valuable component in the development of antifungal drugs.
Used in Chemical Synthesis:
4-METHYL-1,2,3-THIADIAZOLE-5-CARBOXYLIC ACID can also be used as a building block or intermediate in the synthesis of other complex organic compounds. Its unique structure and functional groups make it a versatile component in the creation of new molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 75423-15-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,4,2 and 3 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 75423-15:
(7*7)+(6*5)+(5*4)+(4*2)+(3*3)+(2*1)+(1*5)=123
123 % 10 = 3
So 75423-15-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H6N4OS/c1-2-3(4(9)6-5)10-8-7-2/h5H2,1H3,(H,6,9)
