75493-93-5 Usage
Uses
Used in Pharmaceutical Industry:
1,2,3,4-tetrahydroquinoline-2-carboxylic acid hydrochloride is used as a pharmaceutical intermediate for the development of new drugs due to its unique chemical structure and properties. Its carboxylic acid group allows for the formation of derivatives and conjugates with other molecules, which can be utilized to create novel therapeutic agents.
1,2,3,4-tetrahydroquinoline-2-carboxylic acid hydrochloride is also used as a potential active pharmaceutical ingredient for the treatment of various diseases and conditions. Its specific mechanism of action and therapeutic potential are currently under investigation, with the aim of identifying its potential applications in treating specific medical conditions.
In Medicinal Chemistry Research:
1,2,3,4-tetrahydroquinoline-2-carboxylic acid hydrochloride serves as a valuable compound in medicinal chemistry research. Its unique structure and properties make it a promising candidate for the design and synthesis of new drug molecules. Researchers are exploring its potential interactions with biological targets and its ability to modulate specific biological pathways, which could lead to the discovery of new therapeutic agents.
In Drug Delivery Systems:
The hydrochloride salt form of 1,2,3,4-tetrahydroquinoline-2-carboxylic acid increases its solubility, making it suitable for incorporation into various drug delivery systems. These systems can be designed to improve the bioavailability, stability, and targeted delivery of the compound, enhancing its therapeutic efficacy and reducing potential side effects.
Overall, 1,2,3,4-tetrahydroquinoline-2-carboxylic acid hydrochloride is a versatile chemical compound with significant potential in the pharmaceutical industry. Its applications span from being a pharmaceutical intermediate to a potential active ingredient, as well as a subject of interest in medicinal chemistry research and drug delivery system development. Further research and development efforts are necessary to fully explore and harness its potential in the treatment of various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 75493-93-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,4,9 and 3 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 75493-93:
(7*7)+(6*5)+(5*4)+(4*9)+(3*3)+(2*9)+(1*3)=165
165 % 10 = 5
So 75493-93-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO2.ClH/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-4,9,11H,5-6H2,(H,12,13);1H
