755030-83-2 Usage
Uses
Used in Organic Synthesis:
6-Methyl-2-bromomethylbenzoyl bromide is used as a key intermediate in the synthesis of various specialty chemicals. Its reactivity allows it to be a valuable component in the creation of complex organic molecules.
Used in Pharmaceutical Industry:
6-Methyl-2-bromomethylbenzoyl bromide is used as a building block in the preparation of certain types of pharmaceuticals. Its unique structure contributes to the development of new drug molecules with potential therapeutic applications.
Used in Polymer Industry:
6-Methyl-2-bromomethylbenzoyl bromide is used as a monomer or a component in the synthesis of specific types of polymers. Its incorporation into polymer chains can impart desired properties to the final polymer product, such as improved stability or reactivity.
Safety Considerations:
Due to its reactivity and potential harmful effects, 6-Methyl-2-bromomethylbenzoyl bromide needs to be handled with care. Proper safety measures, such as wearing protective gear and working in a well-ventilated area, should be taken to minimize risks associated with its use.
Check Digit Verification of cas no
The CAS Registry Mumber 755030-83-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,5,5,0,3 and 0 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 755030-83:
(8*7)+(7*5)+(6*5)+(5*0)+(4*3)+(3*0)+(2*8)+(1*3)=152
152 % 10 = 2
So 755030-83-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H8Br2O/c1-6-3-2-4-7(5-10)8(6)9(11)12/h2-4H,5H2,1H3
