755724-85-7 Usage
Uses
Used in Medicinal Chemistry and Drug Development:
D-4-Isopropylphenylalanine is utilized as a key component in the creation of innovative pharmaceutical agents, leveraging its unique structural properties to improve their efficacy, selectivity, and safety profiles. Its incorporation into drug molecules can lead to the development of new therapies with enhanced pharmacological characteristics.
Used in Protein Structure and Function Studies:
In the field of biochemistry, D-4-Isopropylphenylalanine serves as a valuable tool for investigating the structure and function of proteins. By substituting natural amino acids with this derivative, researchers can gain insights into the role of specific amino acid residues in protein folding, stability, and function.
Used in Biotechnology Applications:
D-4-Isopropylphenylalanine is employed as a building block in the development of new biotechnological products, such as engineered enzymes or biocatalysts with altered substrate specificity or improved stability under various conditions. Its unique properties can contribute to the creation of novel bioproducts with applications in industries like pharmaceuticals, agriculture, and environmental management.
Used in Materials Science:
In materials science, D-4-Isopropylphenylalanine is used as a component in the synthesis of new materials with specialized properties. Its incorporation into polymers or other materials can lead to the development of innovative products with applications in various sectors, including electronics, textiles, and coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 755724-85-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,5,5,7,2 and 4 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 755724-85:
(8*7)+(7*5)+(6*5)+(5*7)+(4*2)+(3*4)+(2*8)+(1*5)=197
197 % 10 = 7
So 755724-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H17NO2/c1-8(2)10-5-3-9(4-6-10)7-11(13)12(14)15/h3-6,8,11H,7,13H2,1-2H3,(H,14,15)/t11-/m0/s1
