755750-25-5 Usage
Uses
Used in Pharmaceutical Industry:
1H-Pyrrole-2-carboxylic acid, 5-amino-, ethyl ester (9CI) is used as a key building block for the synthesis of biologically active compounds and drug molecules. Its ethyl ester form allows for easy modification and incorporation into various chemical structures, making it a valuable tool in the development of new pharmaceutical agents.
Used in Research Laboratories:
In research settings, 1H-Pyrrole-2-carboxylic acid, 5-amino-, ethyl ester (9CI) is utilized as a starting material for the synthesis of novel organic molecules and compounds with potential applications in various fields, including medicine, materials science, and chemical biology. Its reactivity and structural diversity make it an attractive candidate for exploring new chemical space and discovering innovative solutions to scientific challenges.
Check Digit Verification of cas no
The CAS Registry Mumber 755750-25-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,5,5,7,5 and 0 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 755750-25:
(8*7)+(7*5)+(6*5)+(5*7)+(4*5)+(3*0)+(2*2)+(1*5)=185
185 % 10 = 5
So 755750-25-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O2/c1-2-11-7(10)5-3-4-6(8)9-5/h3-4,9H,2,8H2,1H3
