755753-61-8 Usage
Uses
Used in Pharmaceutical Applications:
2-AMINO-1H-PYRROLE-3-CARBONITRILE is used as a key intermediate in the synthesis of various pharmaceuticals due to its unique structural features, which allow for the development of new drug candidates with potential therapeutic benefits.
Used in Organic Synthesis:
As a building block in organic synthesis, 2-AMINO-1H-PYRROLE-3-CARBONITRILE is utilized for the creation of diverse heterocyclic compounds, which are essential in the design and synthesis of complex organic molecules with specific properties and applications.
Used in Agrochemical Production:
2-AMINO-1H-PYRROLE-3-CARBONITRILE serves as a precursor in the production of agrochemicals, contributing to the development of new pesticides and other agricultural chemicals that can improve crop protection and yield.
Used in Drug Discovery:
In the field of drug discovery, 2-AMINO-1H-PYRROLE-3-CARBONITRILE is explored for its potential to contribute to the development of novel therapeutic agents, given its demonstrated biological activities and versatility in chemical modifications.
Check Digit Verification of cas no
The CAS Registry Mumber 755753-61-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,5,5,7,5 and 3 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 755753-61:
(8*7)+(7*5)+(6*5)+(5*7)+(4*5)+(3*3)+(2*6)+(1*1)=198
198 % 10 = 8
So 755753-61-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N3/c6-3-4-1-2-8-5(4)7/h1-2,8H,7H2
