75679-31-1 Usage
Uses
Used in Pharmaceutical Industry:
4-hydroxy-3-nitrophenylacetyl-O-succinimide ester is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways.
Used in Chemical Research:
In the field of chemical research, 4-hydroxy-3-nitrophenylacetyl-O-succinimide ester serves as a valuable compound for studying the properties and reactions of esters, as well as their potential applications in various chemical processes.
Used in Material Science:
4-hydroxy-3-nitrophenylacetyl-O-succinimide ester can be utilized as a component in the development of new materials with specific properties, such as improved stability or reactivity. Its unique structure may contribute to the creation of advanced materials for various applications.
Used in Analytical Chemistry:
As an ester with distinct chemical properties, 4-hydroxy-3-nitrophenylacetyl-O-succinimide ester can be employed in analytical chemistry for the detection and quantification of specific compounds or as a reference material in various analytical techniques.
Check Digit Verification of cas no
The CAS Registry Mumber 75679-31-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,6,7 and 9 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 75679-31:
(7*7)+(6*5)+(5*6)+(4*7)+(3*9)+(2*3)+(1*1)=171
171 % 10 = 1
So 75679-31-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H10N2O7/c15-9-2-1-7(5-8(9)14(19)20)6-12(18)21-13-10(16)3-4-11(13)17/h1-2,5,15H,3-4,6H2
