7568-40-3 Usage
Uses
Used in Pharmaceutical Industry:
Glyciphosphoramide is used as a chemical intermediate for the synthesis of various pharmaceuticals, leveraging its unique chemical structure to contribute to the development of new drugs.
Used in Agrochemical Industry:
Glyciphosphoramide is utilized as a chemical intermediate in the production of agrochemicals, particularly for the development of insecticides, due to its insecticidal properties.
Used in Anticancer Research:
Glyciphosphoramide is studied as a potential anticancer agent, exploring its effects on cancer cells and its possible integration into cancer treatment protocols.
Used in Chemical Synthesis:
Due to its reactive nature, glyciphosphoramide is employed in various chemical synthesis processes, where its phosphorus-nitrogen bond can be a key component in creating new compounds with specific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 7568-40-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,6 and 8 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 7568-40:
(6*7)+(5*5)+(4*6)+(3*8)+(2*4)+(1*0)=123
123 % 10 = 3
So 7568-40-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H24Cl2N3O4P/c1-3-20-11(18)9-15-22(16-10-12(19)21-4-2)17(7-5-13)8-6-14/h15-16H,3-10H2,1-2H3
