75724-98-0 Usage
Uses
Used in Organic Synthesis:
2,3,5,6-Tetramethylphenylmagnesium bromide is used as a reagent for the addition of the tetramethylphenyl group to various organic molecules. Its high reactivity allows it to participate in nucleophilic addition reactions, facilitating the formation of new carbon-carbon bonds and contributing to the synthesis of complex organic compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,3,5,6-Tetramethylphenylmagnesium bromide is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its ability to form carbon-carbon bonds and participate in cross-coupling reactions makes it a valuable tool for the development of new drugs and the modification of existing ones.
Used in Material Science:
2,3,5,6-Tetramethylphenylmagnesium bromide is also used in material science for the synthesis of advanced materials with specific properties. Its reactivity and ability to form carbon-carbon and carbon-heteroatom bonds enable the creation of novel materials with potential applications in various fields, such as electronics, energy storage, and polymer chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 75724-98-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,7,2 and 4 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 75724-98:
(7*7)+(6*5)+(5*7)+(4*2)+(3*4)+(2*9)+(1*8)=160
160 % 10 = 0
So 75724-98-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H13.BrH.Mg/c1-7-5-9(3)10(4)6-8(7)2;;/h5H,1-4H3;1H;/q;;+1/p-1/rC10H13BrMg/c1-6-5-7(2)9(4)10(12-11)8(6)3/h5H,1-4H3
