75777-49-0 Usage
Uses
Used in Organic Synthesis:
3,5,6-Trifluoro-2-hydroxypyridine is used as a building block in organic synthesis for its unique structure and reactivity. It is particularly valuable in the creation of pharmaceuticals and agrochemicals, where its fluorine atoms can impart specific properties to the final products, such as increased lipophilicity and metabolic stability.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3,5,6-trifluoro-2-hydroxypyridine is employed as a key intermediate in the synthesis of various drug candidates. Its unique structure allows for the development of novel therapeutic agents with improved pharmacological profiles, including enhanced potency, selectivity, and reduced side effects.
Used in Biological Research:
3,5,6-Trifluoro-2-hydroxypyridine is also used in biological research to study its potential biological activities, such as anti-inflammatory and antitumor properties. Its unique structure and reactivity make it an interesting candidate for the development of new therapeutic agents targeting various diseases and conditions.
Used in Drug Development:
In the pharmaceutical industry, 3,5,6-trifluoro-2-hydroxypyridine is utilized as a starting material or intermediate in the development of new drugs. Its unique structural features and potential biological activities make it a promising candidate for the discovery of innovative therapeutic agents with improved efficacy and safety profiles.
Used in Agrochemical Development:
3,5,6-Trifluoro-2-hydroxypyridine is also used in the agrochemical industry for the development of new pesticides and herbicides. Its unique structure and reactivity can contribute to the creation of more effective and environmentally friendly agrochemicals with targeted modes of action.
Check Digit Verification of cas no
The CAS Registry Mumber 75777-49-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,7,7 and 7 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 75777-49:
(7*7)+(6*5)+(5*7)+(4*7)+(3*7)+(2*4)+(1*9)=180
180 % 10 = 0
So 75777-49-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H2F3NO/c6-2-1-3(7)5(10)9-4(2)8/h1H,(H,9,10)
