75790-47-5 Usage
Uses
Used in Pharmaceutical Synthesis:
N-hydroxyadamantanine is used as a building block in the synthesis of pharmaceuticals for its versatile chemical properties and potential therapeutic benefits.
Used in Polymer Production:
It is utilized in the production of certain polymers, contributing to the development of new materials with specific properties.
Used in Medical Research:
N-hydroxyadamantanine is studied for its potential anti-cancer properties, making it a candidate for further research and development as a therapeutic agent against various types of cancer.
Used in Anti-inflammatory Research:
Its potential anti-inflammatory properties are also being investigated, which could lead to the development of new treatments for inflammatory conditions.
Overall, N-hydroxyadamantanine is a valuable chemical compound with a wide range of applications across different industries, particularly in research and development for medical and material science advancements.
Check Digit Verification of cas no
The CAS Registry Mumber 75790-47-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,7,9 and 0 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 75790-47:
(7*7)+(6*5)+(5*7)+(4*9)+(3*0)+(2*4)+(1*7)=165
165 % 10 = 5
So 75790-47-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H17NO3/c13-10(14)11(12-15)8-2-6-1-7(4-8)5-9(11)3-6/h6-9,12,15H,1-5H2,(H,13,14)
