757978-11-3 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
3-IODO-1H-PYRROLO[2,3-B]PYRIDINE-5-CARBONITRILE is used as a chemical intermediate for the synthesis of biologically active compounds. Its unique structure and properties make it a valuable building block in the development of new pharmaceuticals, potentially leading to the discovery of novel therapeutic agents.
Used in Chemical Synthesis:
In the chemical synthesis industry, 3-IODO-1H-PYRROLO[2,3-B]PYRIDINE-5-CARBONITRILE serves as a key intermediate for the production of various organic compounds. Its versatile structure allows for further functionalization and modification, enabling the creation of a wide range of chemical products with diverse applications.
Used in Medicinal Chemistry:
3-IODO-1H-PYRROLO[2,3-B]PYRIDINE-5-CARBONITRILE is utilized as a starting material in medicinal chemistry for the design and synthesis of new drug candidates. Its heterocyclic nature and the presence of the iodine atom provide opportunities for structure-activity relationship studies, potentially leading to the development of more effective and selective therapeutic agents.
Further research may be warranted to explore the potential applications and uses of 3-IODO-1H-PYRROLO[2,3-B]PYRIDINE-5-CARBONITRILE in various industries, including but not limited to pharmaceuticals, chemical synthesis, and medicinal chemistry. Its unique properties and versatile structure offer promising avenues for the development of innovative products and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 757978-11-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,5,7,9,7 and 8 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 757978-11:
(8*7)+(7*5)+(6*7)+(5*9)+(4*7)+(3*8)+(2*1)+(1*1)=233
233 % 10 = 3
So 757978-11-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H4IN3/c9-7-4-12-8-6(7)1-5(2-10)3-11-8/h1,3-4H,(H,11,12)
