75838-07-2 Usage
General Description
1-(2-Chlorophenyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile is a chemical compound with potential applications in pharmaceutical research and development. It contains a tetrahydropyrimidine ring system with a 2-chlorophenyl group at one end and a carbonitrile group at the other end. This structural arrangement gives the compound potential as a building block for the synthesis of novel drug candidates. Additionally, the carbonitrile group suggests potential for the compound to act as a versatile intermediate in the synthesis of other organic compounds. Its unique structure and potential reactivity make 1-(2-chlorophenyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile an interesting target for further investigation in medicinal chemistry and pharmaceutical development.
Check Digit Verification of cas no
The CAS Registry Mumber 75838-07-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,8,3 and 8 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 75838-07:
(7*7)+(6*5)+(5*8)+(4*3)+(3*8)+(2*0)+(1*7)=162
162 % 10 = 2
So 75838-07-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H6ClN3O2/c12-8-3-1-2-4-9(8)15-6-7(5-13)10(16)14-11(15)17/h1-4,6H,(H,14,16,17)
75838-07-2Relevant articles and documents
Phenyl uracils
-
, (2008/06/13)
Phenyl uracils, synthesis and intermediates therefor, and compositions for the control of pests, especially fungi and bacteria.
