7596-82-9 Usage
Uses
Used in Pharmaceutical Industry:
3-(PIPERIDINOMETHYL)BENZOIC ACID HYDROCHLORIDE 0.5 HYDRATE is used as a building block for drug synthesis due to its distinctive molecular structure and properties. Its potential role in creating new pharmaceutical compounds makes it a valuable asset in drug discovery and development processes.
Used in Organic Chemistry:
3-(PIPERIDINOMETHYL)BENZOIC ACID HYDROCHLORIDE 0.5 HYDRATE is used as a reagent in organic chemistry reactions. Its specific chemical characteristics allow it to participate in various synthesis procedures, contributing to the creation of a wide range of organic compounds.
The hydrate form of the compound, which includes the presence of water molecules, can influence its solubility and stability. These factors are crucial for its application in different industries, as they can affect the compound's behavior during synthesis processes and its overall performance in end products.
Check Digit Verification of cas no
The CAS Registry Mumber 7596-82-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,5,9 and 6 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 7596-82:
(6*7)+(5*5)+(4*9)+(3*6)+(2*8)+(1*2)=139
139 % 10 = 9
So 7596-82-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H17NO2/c15-13(16)12-6-4-5-11(9-12)10-14-7-2-1-3-8-14/h4-6,9H,1-3,7-8,10H2,(H,15,16)
