75969-83-4 Usage
General Description
11-Hydroxycanthin-6-one is a natural alkaloid compound found in various plant species, including the Canthium and Psychotria genera. It is a member of the canthin-6-one family of alkaloids, which are known for their diverse biological activities. 11-Hydroxycanthin-6-one has been found to exhibit significant anti-inflammatory, antimicrobial, and anticancer properties, making it an important compound for potential pharmaceutical applications. Its ability to inhibit the growth of certain cancer cells and reduce inflammation in the body makes it a promising candidate for further research and development in the field of medicinal chemistry. Additionally, its antimicrobial properties make it a potential candidate for the development of novel antibiotics to combat drug-resistant bacteria.
Check Digit Verification of cas no
The CAS Registry Mumber 75969-83-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,9,6 and 9 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 75969-83:
(7*7)+(6*5)+(5*9)+(4*6)+(3*9)+(2*8)+(1*3)=194
194 % 10 = 4
So 75969-83-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H8N2O2/c17-11-3-1-2-10-13(11)8-6-7-15-9-4-5-12(18)16(10)14(8)9/h1-7,15H
