75985-51-2 Usage
Uses
Used in Medicinal Chemistry:
1-(1'(R)-ALPHA-METHYLBENZYL)-AZIRIDINE-2(S)-CARBOXAMIDE is used as a compound with potential pharmacological applications due to its unique molecular structure and chirality, which may contribute to its biological activity and reactivity.
Used in Pharmaceutical Research:
In pharmaceutical research, 1-(1'(R)-ALPHA-METHYLBENZYL)-AZIRIDINE-2(S)-CARBOXAMIDE is utilized as a compound of interest for its potential role in the development of new drugs, given its distinctive chemical features and possible interactions with biological systems.
Used as a Synthetic Intermediate in Organic Chemistry:
1-(1'(R)-ALPHA-METHYLBENZYL)-AZIRIDINE-2(S)-CARBOXAMIDE serves as a synthetic intermediate in organic chemistry, where its complex structure and functional groups can be employed in the synthesis of more complex molecules or used to study reaction mechanisms and pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 75985-51-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,5,9,8 and 5 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 75985-51:
(7*7)+(6*5)+(5*9)+(4*8)+(3*5)+(2*5)+(1*1)=182
182 % 10 = 2
So 75985-51-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N2O/c1-8(9-5-3-2-4-6-9)13-7-10(13)11(12)14/h2-6,8,10H,7H2,1H3,(H2,12,14)/t8-,10+,13?/m1/s1
